|
CAS#: 63264-73-3 Product: 3-(Allyloxy)-2-Bromopropyl Dihydrogen Phosphate No suppilers available for the product. |
| Name | 3-(Allyloxy)-2-Bromopropyl Dihydrogen Phosphate |
|---|---|
| Synonyms | (3-Allyloxy-2-Bromo-Propyl) Dihydrogen Phosphate; (3-Allyloxy-2-Bromopropyl) Dihydrogen Phosphate; (2-Bromo-3-Prop-2-Enoxy-Propyl) Dihydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12BrO5P |
| Molecular Weight | 275.04 |
| CAS Registry Number | 63264-73-3 |
| EINECS | 264-058-0 |
| SMILES | C(C(Br)COCC=C)O[P](=O)(O)O |
| InChI | 1S/C6H12BrO5P/c1-2-3-11-4-6(7)5-12-13(8,9)10/h2,6H,1,3-5H2,(H2,8,9,10) |
| InChIKey | MHKZSDZGFSXPFG-UHFFFAOYSA-N |
| Density | 1.636g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.351°C at 760 mmHg (Cal.) |
| Flash point | 198.949°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Allyloxy)-2-Bromopropyl Dihydrogen Phosphate |