|
CAS#: 6328-76-3 Product: Methyl 9-Bromofluorene-9-Carboxylate No suppilers available for the product. |
| Name | Methyl 9-Bromofluorene-9-Carboxylate |
|---|---|
| Synonyms | 9-Bromo-9-Fluorenecarboxylic Acid Methyl Ester; 9-Bromofluorene-9-Carboxylic Acid Methyl Ester; Nsc43860 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11BrO2 |
| Molecular Weight | 303.15 |
| CAS Registry Number | 6328-76-3 |
| SMILES | C1=CC=CC2=C1C(C3=C2C=CC=C3)(C(OC)=O)Br |
| InChI | 1S/C15H11BrO2/c1-18-14(17)15(16)12-8-4-2-6-10(12)11-7-3-5-9-13(11)15/h2-9H,1H3 |
| InChIKey | LPFNZUQDSQYWTN-UHFFFAOYSA-N |
| Density | 1.525g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.697°C at 760 mmHg (Cal.) |
| Flash point | 176.782°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 9-Bromofluorene-9-Carboxylate |