|
CAS#: 6330-40-1 Product: 2-(3-Nitrophenyl)-2-Oxo-Acetic Acid No suppilers available for the product. |
| Name | 2-(3-Nitrophenyl)-2-Oxo-Acetic Acid |
|---|---|
| Synonyms | 2-(3-Nitrophenyl)-2-Oxo-Acetic Acid; 2-Keto-2-(3-Nitrophenyl)Acetic Acid; 2-(3-Nitrophenyl)-2-Oxo-Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5NO5 |
| Molecular Weight | 195.13 |
| CAS Registry Number | 6330-40-1 |
| SMILES | C1=CC=C(C=C1C(C(O)=O)=O)[N+]([O-])=O |
| InChI | 1S/C8H5NO5/c10-7(8(11)12)5-2-1-3-6(4-5)9(13)14/h1-4H,(H,11,12) |
| InChIKey | WFLZZURFYPMNDF-UHFFFAOYSA-N |
| Density | 1.531g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.58°C at 760 mmHg (Cal.) |
| Flash point | 162.035°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Nitrophenyl)-2-Oxo-Acetic Acid |