|
CAS#: 63321-50-6 Product: 4-Nitrophenyl N-Butylcarbamate No suppilers available for the product. |
| Name | 4-Nitrophenyl N-Butylcarbamate |
|---|---|
| Synonyms | N-Butylcarbamic Acid (4-Nitrophenyl) Ester; Carbamic Acid, Butyl-, 4-Nitrophenyl Ester; 4-Nitrophenyl N-Butylcarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 63321-50-6 |
| SMILES | C1=C(C=CC(=C1)[N+]([O-])=O)OC(NCCCC)=O |
| InChI | 1S/C11H14N2O4/c1-2-3-8-12-11(14)17-10-6-4-9(5-7-10)13(15)16/h4-7H,2-3,8H2,1H3,(H,12,14) |
| InChIKey | LXLRTTHROGSMBS-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.507°C at 760 mmHg (Cal.) |
| Flash point | 168.805°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenyl N-Butylcarbamate |