|
CAS#: 63323-91-1 Product: 1-O-Phosphonato-D-Xylulose No suppilers available for the product. |
| Name | 1-O-Phosphonato-D-Xylulose |
|---|---|
| Synonyms | D-Xylulose 1-phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H9O8P |
| Molecular Weight | 228.10 |
| CAS Registry Number | 63323-91-1 |
| SMILES | C([C@H]([C@@H](C(=O)COP(=O)([O-])[O-])O)O)O |
| InChI | 1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h3,5-7,9H,1-2H2,(H2,10,11,12)/p-2/t3-,5+/m1/s1 |
| InChIKey | NBOCCPQHBPGYCX-WUJLRWPWSA-L |
| Density | 1.812g/cm3 (Cal.) |
|---|---|
| Boiling point | 622.736°C at 760 mmHg (Cal.) |
| Flash point | 330.419°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-O-Phosphonato-D-Xylulose |