|
CAS#: 6334-91-4 Product: 2-Hydroxy-2,2-Bis(4-Phenylphenyl)Acetic Acid No suppilers available for the product. |
| Name | 2-Hydroxy-2,2-Bis(4-Phenylphenyl)Acetic Acid |
|---|---|
| Synonyms | 2-Hydroxy-2,2-Bis(4-Phenylphenyl)Ethanoic Acid; Ncistruc2_001076; Nci28086 |
| Molecular Structure | ![]() |
| Molecular Formula | C26H20O3 |
| Molecular Weight | 380.44 |
| CAS Registry Number | 6334-91-4 |
| SMILES | C3=C(C(C(O)=O)(O)C1=CC=C(C=C1)C2=CC=CC=C2)C=CC(=C3)C4=CC=CC=C4 |
| InChI | 1S/C26H20O3/c27-25(28)26(29,23-15-11-21(12-16-23)19-7-3-1-4-8-19)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18,29H,(H,27,28) |
| InChIKey | ZAINQWJQOUCQDK-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.742°C at 760 mmHg (Cal.) |
| Flash point | 325.104°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-2,2-Bis(4-Phenylphenyl)Acetic Acid |