|
CAS#: 6338-59-6 Product: 2-Amino-5-(4-Amino-3-Carboxy-Phenyl)Sulfonyl-Benzoic Acid No suppilers available for the product. |
| Name | 2-Amino-5-(4-Amino-3-Carboxy-Phenyl)Sulfonyl-Benzoic Acid |
|---|---|
| Synonyms | 2-Amino-5-(4-Amino-3-Carboxy-Phenyl)Sulfonyl-Benzoic Acid; Nsc40767 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.32 |
| CAS Registry Number | 6338-59-6 |
| SMILES | C1=C(C=CC(=C1C(=O)O)N)[S](=O)(=O)C2=CC(=C(N)C=C2)C(O)=O |
| InChI | 1S/C14H12N2O6S/c15-11-3-1-7(5-9(11)13(17)18)23(21,22)8-2-4-12(16)10(6-8)14(19)20/h1-6H,15-16H2,(H,17,18)(H,19,20) |
| InChIKey | GSBAMPHXDICKMU-UHFFFAOYSA-N |
| Density | 1.621g/cm3 (Cal.) |
|---|---|
| Boiling point | 699.523°C at 760 mmHg (Cal.) |
| Flash point | 376.858°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-5-(4-Amino-3-Carboxy-Phenyl)Sulfonyl-Benzoic Acid |