|
CAS#: 6339-93-1 Product: 1,2-Dipyridin-3-Ylethanone No suppilers available for the product. |
| Name | 1,2-Dipyridin-3-Ylethanone |
|---|---|
| Synonyms | 1,2-Bis(3-Pyridyl)Ethanone; Nsc42653 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 |
| CAS Registry Number | 6339-93-1 |
| SMILES | C2=CC=C(CC(C1=CC=CN=C1)=O)C=N2 |
| InChI | 1S/C12H10N2O/c15-12(11-4-2-6-14-9-11)7-10-3-1-5-13-8-10/h1-6,8-9H,7H2 |
| InChIKey | FLFVIUINVVIJPA-UHFFFAOYSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.163°C at 760 mmHg (Cal.) |
| Flash point | 189.203°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dipyridin-3-Ylethanone |