|
CAS#: 63421-93-2 Product: 3-(5-Nitro-2-Furyl)-1-(4-Pyridyl)-2-Propen-1-One No suppilers available for the product. |
| Name | 3-(5-Nitro-2-Furyl)-1-(4-Pyridyl)-2-Propen-1-One |
|---|---|
| Synonyms | (E)-3-(5-Nitro-2-Furyl)-1-(4-Pyridyl)Prop-2-En-1-One; (E)-3-(5-Nitrofuran-2-Yl)-1-Pyridin-4-Yl-Prop-2-En-1-One; 3-(5-Nitro-2-Furyl)-1-(4-Pyridyl)-2-Propen-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 |
| CAS Registry Number | 63421-93-2 |
| SMILES | C1=C(OC(=C1)\C=C\C(=O)C2=CC=NC=C2)[N+]([O-])=O |
| InChI | 1S/C12H8N2O4/c15-11(9-5-7-13-8-6-9)3-1-10-2-4-12(18-10)14(16)17/h1-8H/b3-1+ |
| InChIKey | PZNATEXTAXWHMN-HNQUOIGGSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.495°C at 760 mmHg (Cal.) |
| Flash point | 208.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(5-Nitro-2-Furyl)-1-(4-Pyridyl)-2-Propen-1-One |