Online Database of Chemicals from Around the World
|
CAS#: 63428-98-8 Product: 2,4-Bis(1,1-Dimethylethyl)-6-(1-Phenylethyl)Phenol No suppilers available for the product. |
| Name | 2,4-Bis(1,1-Dimethylethyl)-6-(1-Phenylethyl)Phenol |
|---|---|
| Synonyms | Brn 1995835; 2,4-Bis(1,1-Dimethylethyl)-6-(1-Phenylethyl)Phenol; 2,4-Di-Tert-Butyl-6-(Alpha-Methylbenzyl)Phenol |
| Molecular Structure |  |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 |
| CAS Registry Number | 63428-98-8 |
| SMILES | C1=CC=C(C=C1)C(C2=C(O)C(=CC(=C2)C(C)(C)C)C(C)(C)C)C |
| InChI | 1S/C22H30O/c1-15(16-11-9-8-10-12-16)18-13-17(21(2,3)4)14-19(20(18)23)22(5,6)7/h8-15,23H,1-7H3 |
| InChIKey | XOVCWYXPFJNQLU-UHFFFAOYSA-N |
| Density | 0.977g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.629°C at 760 mmHg (Cal.) |
| Flash point | 169.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis(1,1-Dimethylethyl)-6-(1-Phenylethyl)Phenol |