|
CAS#: 63450-69-1 Product: Dihexyl Disulphone No suppilers available for the product. |
| Name | Dihexyl Disulphone |
|---|---|
| Synonyms | Dihexyl Disulphone; Disulfone, Dihexyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26O4S2 |
| Molecular Weight | 298.46 |
| CAS Registry Number | 63450-69-1 |
| EINECS | 264-178-3 |
| SMILES | C([S]([S](=O)(=O)CCCCCC)(=O)=O)CCCCC |
| InChI | 1S/C12H26O4S2/c1-3-5-7-9-11-17(13,14)18(15,16)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | BLSCDQQJQHAYRZ-UHFFFAOYSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.375°C at 760 mmHg (Cal.) |
| Flash point | 227.202°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihexyl Disulphone |