Online Database of Chemicals from Around the World
|
CAS#: 63467-37-8 Product: 8,9-Dihydro-2-Methylnaphtho[1,2-d]Thiazole No suppilers available for the product. |
| Name | 8,9-Dihydro-2-Methylnaphtho[1,2-d]Thiazole |
|---|---|
| Synonyms | 8,9-Dihydro-2-Methylnaphtho(1,2-D)Thiazole; Naphtho(1,2-D)Thiazole, 8,9-Dihydro-2-Methyl- |
| Molecular Structure | ![CAS#: 63467-37-8, 8,9-Dihydro-2-Methylnaphtho[1,2-d]Thiazole](/moreStructures/63467-37-8.gif) |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 |
| CAS Registry Number | 63467-37-8 |
| EINECS | 264-238-9 |
| SMILES | C1=CC3=C(C2=C1SC(=N2)C)CCC=C3 |
| InChI | 1S/C12H11NS/c1-8-13-12-10-5-3-2-4-9(10)6-7-11(12)14-8/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | QEUUFJLLFQIUQH-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.087°C at 760 mmHg (Cal.) |
| Flash point | 160.197°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,9-Dihydro-2-Methylnaphtho[1,2-d]Thiazole |