Online Database of Chemicals from Around the World
|
CAS#: 63493-73-2 Product: 7,8,9,10-Tetrahydro-1,7,8,10,11-Pentahydroxy-3,9-Dimethoxy-8-Methylnaphthacene-5,12-Dione No suppilers available for the product. |
| Name | 7,8,9,10-Tetrahydro-1,7,8,10,11-Pentahydroxy-3,9-Dimethoxy-8-Methylnaphthacene-5,12-Dione |
|---|---|
| Synonyms | 4,6,7,9,10-Pentahydroxy-2,8-Dimethoxy-9-Methyl-8,10-Dihydro-7H-Tetracene-5,12-Quinone; Steffimycinol; U 51206 |
| Molecular Structure |  |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 |
| CAS Registry Number | 63493-73-2 |
| SMILES | C1=C(C4=C(C=C1OC)C(C3=C(C(=C2C(C(C(O)(C(C2=C3)O)C)OC)O)O)C4=O)=O)O |
| InChI | 1S/C21H20O9/c1-21(28)19(27)10-6-9-13(17(25)14(10)18(26)20(21)30-3)16(24)12-8(15(9)23)4-7(29-2)5-11(12)22/h4-6,18-20,22,25-28H,1-3H3 |
| InChIKey | GELQCQRLAMAWDN-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 725.023°C at 760 mmHg (Cal.) |
| Flash point | 258.861°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,9,10-Tetrahydro-1,7,8,10,11-Pentahydroxy-3,9-Dimethoxy-8-Methylnaphthacene-5,12-Dione |