|
CAS#: 63505-68-0 Product: alpha-D-Glucopyranose, 2,6-bis(3-nitropropanoate) No suppilers available for the product. |
| Name | alpha-D-Glucopyranose, 2,6-bis(3-nitropropanoate) |
|---|---|
| Synonyms | [(2R,3S,4S,5R,6S)-3,4,6-Trihydroxy-5-(3-Nitropropanoyloxy)Tetrahydropyran-2-Yl]Methyl 3-Nitropropanoate; 3-Nitropropanoic Acid [(2R,3S,4S,5R,6S)-3,4,6-Trihydroxy-5-(3-Nitro-1-Oxopropoxy)-2-Tetrahydropyranyl]Methyl Ester; 3-Nitropropionic Acid [(2R,3S,4S,5R,6S)-3,4,6-Trihydroxy-5-(3-Nitropropanoyloxy)Tetrahydropyran-2-Yl]Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N2O12 |
| Molecular Weight | 382.28 |
| CAS Registry Number | 63505-68-0 |
| SMILES | [C@H]1([C@H]([C@H](O)[C@H](O[C@@H]1O)COC(CC[N+]([O-])=O)=O)O)OC(CC[N+]([O-])=O)=O |
| InChI | 1S/C12H18N2O12/c15-7(1-3-13(20)21)24-5-6-9(17)10(18)11(12(19)25-6)26-8(16)2-4-14(22)23/h6,9-12,17-19H,1-5H2/t6-,9-,10+,11-,12+/m1/s1 |
| InChIKey | VDUXCWJUZIOGJA-JPXBYFMYSA-N |
| Density | 1.595g/cm3 (Cal.) |
|---|---|
| Boiling point | 634.263°C at 760 mmHg (Cal.) |
| Flash point | 337.391°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-D-Glucopyranose, 2,6-bis(3-nitropropanoate) |