|
CAS#: 63528-87-0 Product: Benzo[a]Pyrene-7,8-Diol-9,10-Epoxide No suppilers available for the product. |
| Name | Benzo[a]Pyrene-7,8-Diol-9,10-Epoxide |
|---|---|
| Synonyms | Benzo(10,11)Chryseno(3,4-B)Oxirene-7,8-Diol, 8A,9A-Dihydro-; Benzo(A)Pyrene-7,8-Diol-9,10-Epoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O3 |
| Molecular Weight | 300.31 |
| CAS Registry Number | 63528-87-0 |
| SMILES | C2=C6C1=C5C(=CC=C1C3=C2C(=C(O)C4OC34)O)C=CC=C5C=C6 |
| InChI | 1S/C20H12O3/c21-17-13-8-11-5-4-9-2-1-3-10-6-7-12(15(11)14(9)10)16(13)19-20(23-19)18(17)22/h1-8,19-22H |
| InChIKey | OKMMPIIEAWVGFU-UHFFFAOYSA-N |
| Density | 1.651g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.873°C at 760 mmHg (Cal.) |
| Flash point | 322.035°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[a]Pyrene-7,8-Diol-9,10-Epoxide |