|
CAS#: 63569-19-7 Product: Methyl (16alpha,19alpha)-17-Methoxy-19-Methyl-18-Oxayohimban-16-Carboxylate No suppilers available for the product. |
| Name | Methyl (16alpha,19alpha)-17-Methoxy-19-Methyl-18-Oxayohimban-16-Carboxylate |
|---|---|
| Synonyms | methyl (1 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.47 |
| CAS Registry Number | 63569-19-7 |
| EINECS | 264-323-0 |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@@H]3N(C[C@@H]2[C@H](C)OC1OC)CCc4c5ccccc5nc34 |
| InChI | 1S/C22H28N2O4/c1-12-16-11-24-9-8-14-13-6-4-5-7-17(13)23-20(14)18(24)10-15(16)19(21(25)26-2)22(27-3)28-12/h4-7,12,15-16,18-19,22-23H,8-11H2,1-3H3/t12-,15-,16+,18-,19-,22?/m0/s1 |
| InChIKey | IXOBRDZTISLXQS-AMNPBPSFSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.809°C at 760 mmHg (Cal.) |
| Flash point | 275.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (16alpha,19alpha)-17-Methoxy-19-Methyl-18-Oxayohimban-16-Carboxylate |