| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | 2,5-Dimethoxy-4-(4-Nitrophenylazo)Aniline |
|---|---|
| Synonyms | 2,5-Dimethoxy-4-(4-Nitrophenyl)Azo-Aniline; 2,5-Dimethoxy-4-(4-Nitrophenyl)Azoaniline; [2,5-Dimethoxy-4-(4-Nitrophenyl)Azo-Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 |
| CAS Registry Number | 6358-51-6 |
| EINECS | 228-777-3 |
| SMILES | C1=C(OC)C(=CC(=C1N=NC2=CC=C([N+]([O-])=O)C=C2)OC)N |
| InChI | 1S/C14H14N4O4/c1-21-13-8-12(14(22-2)7-11(13)15)17-16-9-3-5-10(6-4-9)18(19)20/h3-8H,15H2,1-2H3 |
| InChIKey | KBJGBAOGDZOYIZ-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.756°C at 760 mmHg (Cal.) |
| Flash point | 277.211°C (Cal.) |
| (1) | Timothy L. Foley, Adam Yasgar, Christopher J. Garcia, Ajit Jadhav, Anton Simeonov and Michael D. Burkart. Preparation of FRET reporters to support chemical probe development, Org. Biomol. Chem., 2010, 8, 4601. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethoxy-4-(4-Nitrophenylazo)Aniline |