Online Database of Chemicals from Around the World
| Specs Ltd. | Netherlands | Inquire | ||
|---|---|---|---|---|
 |
+31 (15) 251-8111 | |||
 |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | 2-[(4-Chlorophenyl)Azo]-1H-Imidazole |
|---|---|
| Synonyms | 4-Chloro-N-(2-Imidazolylideneamino)Aniline; (4-Chlorophenyl)-(Imidazol-2-Ylideneamino)Amine; Ag-690/09409022 |
| Molecular Structure | ![CAS#: 63589-28-6, 2-[(4-Chlorophenyl)Azo]-1H-Imidazole](/moreStructures/63589-28-6.gif) |
| Molecular Formula | C9H7ClN4 |
| Molecular Weight | 206.63 |
| CAS Registry Number | 63589-28-6 |
| EINECS | 264-350-8 |
| SMILES | C2=C(NN=C1N=CC=N1)C=CC(=C2)Cl |
| InChI | 1S/C9H7ClN4/c10-7-1-3-8(4-2-7)13-14-9-11-5-6-12-9/h1-6,13H |
| InChIKey | VPCPXZDBUVJUNL-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.801°C at 760 mmHg (Cal.) |
| Flash point | 146.606°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Chlorophenyl)Azo]-1H-Imidazole |