Online Database of Chemicals from Around the World
|
CAS#: 63618-49-5 Product: 1,1'-[Hexamethylenebis(Oxy)]Bis[Pentabromobenzene] No suppilers available for the product. |
| Name | 1,1'-[Hexamethylenebis(Oxy)]Bis[Pentabromobenzene] |
|---|---|
| Synonyms | 1,1'-(Hexamethylenebis(Oxy))Bis(Pentabromobenzene) |
| Molecular Structure | ![CAS#: 63618-49-5, 1,1'-[Hexamethylenebis(Oxy)]Bis[Pentabromobenzene]](/moreStructures/63618-49-5.gif) |
| Molecular Formula | C18H16Br10O2 |
| Molecular Weight | 1063.36 |
| CAS Registry Number | 63618-49-5 |
| EINECS | 264-371-2 |
| SMILES | C(OC1(C(=C(C(=C(C1)Br)Br)Br)Br)Br)CCCCCOC2(C(=C(C(=C(C2)Br)Br)Br)Br)Br |
| InChI | 1S/C18H16Br10O2/c19-9-7-17(27,15(25)13(23)11(9)21)29-5-3-1-2-4-6-30-18(28)8-10(20)12(22)14(24)16(18)26/h1-8H2 |
| InChIKey | JZCMAVQSSURUOI-UHFFFAOYSA-N |
| Density | 2.627g/cm3 (Cal.) |
|---|---|
| Boiling point | 640.448°C at 760 mmHg (Cal.) |
| Flash point | 271.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[Hexamethylenebis(Oxy)]Bis[Pentabromobenzene] |