| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2-Methoxy-2-(1-Naphthyl)Propanoic Acid |
|---|---|
| Synonyms | (R)-(-)-2-Methoxy-2-(1-naphthyl)propionic Acid; (S)-(+)-α-Methoxy-α-Methyl-1-Naphthaleneacetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 |
| CAS Registry Number | 63628-25-1 |
| SMILES | O=C(O)C(OC)(c2cccc1ccccc12)C |
| InChI | 1S/C14H14O3/c1-14(17-2,13(15)16)12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,1-2H3,(H,15,16) |
| InChIKey | YVWMPILNFZOQSZ-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Melting point | 158°C (Expl.) |
| Boiling point | 403.571°C at 760 mmHg (Cal.) |
| Flash point | 154.388°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Akio Ichikawa, Hiroshi Ono, Takuya Echigo and Yuji Mikata. Crystal structures and chiral recognition of the diastereomeric salts prepared from 2-methoxy-2-(1-naphthyl)propanoic acid, CrystEngComm, 2011, 13, 4536. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-2-(1-Naphthyl)Propanoic Acid |