| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Specs Ltd. | Netherlands | Inquire | ||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 9,10-Dioxo-9,10-Dihydroanthracene-2-Carbaldehyde |
|---|---|
| Synonyms | 9,10-Dioxo-2-Anthracenecarboxaldehyde; 9,10-Diketoanthracene-2-Carbaldehyde; 2-Anthraldehyde, 9,10-Dihydro-9,10-Dioxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H8O3 |
| Molecular Weight | 236.23 |
| CAS Registry Number | 6363-86-6 |
| SMILES | C1=C(C=O)C=CC2=C1C(C3=C(C2=O)C=CC=C3)=O |
| InChI | 1S/C15H8O3/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-8H |
| InChIKey | XBWFYFHSIFEXMY-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.27°C at 760 mmHg (Cal.) |
| Flash point | 204.347°C (Cal.) |
| (1) | Matthew Lukeman, Musheng Xu and Peter Wan. Excited state intramolecular redox reaction of 2-(hydroxymethyl)anthraquinone; in aqueous solution, Chem. Commun., 2002, 0, 136. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 9,10-Dioxo-9,10-Dihydroanthracene-2-Carbaldehyde |