Online Database of Chemicals from Around the World
|
CAS#: 6366-24-1 Product: 10-Chloro-7-Methylbenz[a]Anthracene No suppilers available for the product. |
| Name | 10-Chloro-7-Methylbenz[a]Anthracene |
|---|---|
| Synonyms | 10-Chloro-7-Methyl-Benzo[B]Phenanthrene; 10-Chloro-7-Methylbenz(A)Anthracene; 7-Chloro-10-Methyl-1,2-Benzanthracene |
| Molecular Structure | ![CAS#: 6366-24-1, 10-Chloro-7-Methylbenz[a]Anthracene](/moreStructures/6366-24-1.gif) |
| Molecular Formula | C19H13Cl |
| Molecular Weight | 276.76 |
| CAS Registry Number | 6366-24-1 |
| SMILES | C1=C3C(=C(C2=CC=C(C=C12)Cl)C)C=CC4=C3C=CC=C4 |
| InChI | 1S/C19H13Cl/c1-12-16-9-7-15(20)10-14(16)11-19-17(12)8-6-13-4-2-3-5-18(13)19/h2-11H,1H3 |
| InChIKey | JUWMMXBWSDLPQJ-UHFFFAOYSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.235°C at 760 mmHg (Cal.) |
| Flash point | 232.255°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Chloro-7-Methylbenz[a]Anthracene |