|
CAS#: 63679-74-3 Product: o-Biphenyl-2-(2-Aminoethyl)-Isothiouronium Sulfate No suppilers available for the product. |
| Name | o-Biphenyl-2-(2-Aminoethyl)-Isothiouronium Sulfate |
|---|---|
| Synonyms | 1-(2-Aminoethylsulfanyl)-N'-(2-Phenylphenyl)Formamidine; Sulfuric Acid; 1-(2-Aminoethylthio)-N'-(2-Phenylphenyl)Formamidine; Sulfuric Acid; Pseudourea, 2-(2-Aminoethyl)-1-(O-Biphenylyl)-2-Thio-, Hydrogen Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.45 |
| CAS Registry Number | 63679-74-3 |
| SMILES | C1=CC=CC(=C1C2=CC=CC=C2)N=C(SCCN)N.O=[S](=O)(O)O |
| InChI | 1S/C15H17N3S.H2O4S/c16-10-11-19-15(17)18-14-9-5-4-8-13(14)12-6-2-1-3-7-12;1-5(2,3)4/h1-9H,10-11,16H2,(H2,17,18);(H2,1,2,3,4) |
| InChIKey | XNNXQKVEXMHAKS-UHFFFAOYSA-N |
| Boiling point | 482.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 245.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for o-Biphenyl-2-(2-Aminoethyl)-Isothiouronium Sulfate |