| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Trimethylamine 2,4,5-Trichlorophenoxyacetate |
|---|---|
| Synonyms | 2-(2,4,5-Trichlorophenoxy)Acetic Acid; Trimethylamine; N,N-Dimethylmethanamine; 2-(2,4,5-Trichlorophenoxy)Ethanoic Acid; Acetic Acid, (2,4,5-Trichlorophenoxy)-, Compd. With Trimethylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14Cl3NO3 |
| Molecular Weight | 314.60 |
| CAS Registry Number | 6369-96-6 |
| SMILES | C1=C(Cl)C(=CC(=C1OCC(=O)O)Cl)Cl.CN(C)C |
| InChI | 1S/C8H5Cl3O3.C3H9N/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13;1-4(2)3/h1-2H,3H2,(H,12,13);1-3H3 |
| InChIKey | NIUIAPURUKNXIY-UHFFFAOYSA-N |
| Boiling point | 376.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 181.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylamine 2,4,5-Trichlorophenoxyacetate |