|
CAS#: 63716-26-7 Product: 1-Methyl-2-(2-Methylphenyloxy)Ethyl Carbamate No suppilers available for the product. |
| Name | 1-Methyl-2-(2-Methylphenyloxy)Ethyl Carbamate |
|---|---|
| Synonyms | [1-Methyl-2-(2-Methylphenoxy)Ethyl] Carbamate; Carbamic Acid [1-Methyl-2-(2-Methylphenoxy)Ethyl] Ester; 2-Propanol, 1-(2-Methylphenoxy)-, Carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 63716-26-7 |
| SMILES | C1=C(C(=CC=C1)C)OCC(OC(N)=O)C |
| InChI | 1S/C11H15NO3/c1-8-5-3-4-6-10(8)14-7-9(2)15-11(12)13/h3-6,9H,7H2,1-2H3,(H2,12,13) |
| InChIKey | QFQQCSOIKYRSMA-UHFFFAOYSA-N |
| Density | 1.12g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.229°C at 760 mmHg (Cal.) |
| Flash point | 183.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-(2-Methylphenyloxy)Ethyl Carbamate |