|
CAS#: 63729-84-0 Product: 4,5alpha-Epoxy-17-Methylmorphinan-3,8beta-Diol No suppilers available for the product. |
| Name | 4,5alpha-Epoxy-17-Methylmorphinan-3,8beta-Diol |
|---|---|
| Synonyms | Morphinan-3,8-Beta-Diol, 4,5-Alpha-Epoxy-17-Methyl-; Beta-Isomorphine, Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 |
| CAS Registry Number | 63729-84-0 |
| SMILES | [C@@H]15CC4=C3[C@@]2([C@H]1C(O)CC[C@@H]2OC3=C(C=C4)O)CCN5C |
| InChI | 1S/C17H21NO3/c1-18-7-6-17-13-5-4-11(19)15(17)10(18)8-9-2-3-12(20)16(21-13)14(9)17/h2-3,10-11,13,15,19-20H,4-8H2,1H3/t10-,11?,13+,15-,17-/m1/s1 |
| InChIKey | UZBOXKCKSVVZGQ-LJURKPAWSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.715°C at 760 mmHg (Cal.) |
| Flash point | 248.157°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5alpha-Epoxy-17-Methylmorphinan-3,8beta-Diol |