|
CAS#: 63732-72-9 Product: 4,5alpha-Epoxy-3-Ethoxy-17-Methylmorphinan-8alpha-Ol No suppilers available for the product. |
| Name | 4,5alpha-Epoxy-3-Ethoxy-17-Methylmorphinan-8alpha-Ol |
|---|---|
| Synonyms | Brn 0094129; Ethyldihydro-Gamma-Isomorphine; Morphinan-8-Alpha-Ol, 4,5-Alpha-Epoxy-3-Ethoxy-17-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 |
| CAS Registry Number | 63732-72-9 |
| SMILES | [C@H]4(O)[C@H]1[C@H]5CC3=C2[C@]1([C@@H](OC2=C(C=C3)OCC)CC4)CCN5C |
| InChI | 1S/C19H25NO3/c1-3-22-14-6-4-11-10-12-17-13(21)5-7-15-19(17,8-9-20(12)2)16(11)18(14)23-15/h4,6,12-13,15,17,21H,3,5,7-10H2,1-2H3/t12-,13-,15+,17-,19-/m1/s1 |
| InChIKey | PZIUJWMPKZGXBF-POORPVJTSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.246°C at 760 mmHg (Cal.) |
| Flash point | 245.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5alpha-Epoxy-3-Ethoxy-17-Methylmorphinan-8alpha-Ol |