|
CAS#: 63768-01-4 Product: 1-(Butylamino)-4-Hydroxyanthraquinone No suppilers available for the product. |
| Name | 1-(Butylamino)-4-Hydroxyanthraquinone |
|---|---|
| Synonyms | 1-Butylamino-4-Hydroxy-Anthracene-9,10-Dione; 1-Butylamino-4-Hydroxy-9,10-Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 |
| CAS Registry Number | 63768-01-4 |
| EINECS | 264-453-8 |
| SMILES | C1=CC(=C2C(=C1NCCCC)C(=O)C3=C(C2=O)C=CC=C3)O |
| InChI | 1S/C18H17NO3/c1-2-3-10-19-13-8-9-14(20)16-15(13)17(21)11-6-4-5-7-12(11)18(16)22/h4-9,19-20H,2-3,10H2,1H3 |
| InChIKey | MLZFWBQTQKBDSJ-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.581°C at 760 mmHg (Cal.) |
| Flash point | 266.824°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Butylamino)-4-Hydroxyanthraquinone |