|
CAS#: 6379-37-9 Product: Octylammonium methanearsonate No suppilers available for the product. |
| Name | Octylammonium methanearsonate |
|---|---|
| Synonyms | Hydroxy-Methyl-Arsinate; Octylammonium; Hydroxy-Methylarsinate; Octylammonium; Hydroxy-Methyl-Arsinate; Octylazanium |
| Molecular Structure | ![]() |
| Molecular Formula | C9H24AsNO3 |
| Molecular Weight | 269.22 |
| CAS Registry Number | 6379-37-9 |
| SMILES | C[As]([O-])(=O)O.C(CCC[NH3+])CCCC |
| InChI | 1S/C8H19N.CH5AsO3/c1-2-3-4-5-6-7-8-9;1-2(3,4)5/h2-9H2,1H3;1H3,(H2,3,4,5) |
| InChIKey | ZQNCPBWKWATILB-UHFFFAOYSA-N |
| Boiling point | 179.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 62.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octylammonium methanearsonate |