|
CAS#: 63814-25-5 Product: 13,14-Dihydro-16-Phenyl-omega-Tetranorprostaglandin E2 No suppilers available for the product. |
| Name | 13,14-Dihydro-16-Phenyl-omega-Tetranorprostaglandin E2 |
|---|---|
| Synonyms | (Z)-7-[(1R,2R,3R)-3-Hydroxy-2-(3-Hydroxy-4-Phenyl-Butyl)-5-Oxo-Cyclopentyl]Hept-5-Enoic Acid; (Z)-7-[(1R,2R,3R)-3-Hydroxy-2-(3-Hydroxy-4-Phenyl-Butyl)-5-Keto-Cyclopentyl]Hept-5-Enoic Acid; 13,14-Dhphtnpge2 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 |
| CAS Registry Number | 63814-25-5 |
| SMILES | [C@H]1([C@H](C(C[C@H]1O)=O)C\C=C/CCCC(=O)O)CCC(CC2=CC=CC=C2)O |
| InChI | 1S/C22H30O5/c23-17(14-16-8-4-3-5-9-16)12-13-19-18(20(24)15-21(19)25)10-6-1-2-7-11-22(26)27/h1,3-6,8-9,17-19,21,23,25H,2,7,10-15H2,(H,26,27)/b6-1-/t17?,18-,19-,21-/m1/s1 |
| InChIKey | UNNWTQCYFXZRNE-REMLESFQSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.22°C at 760 mmHg (Cal.) |
| Flash point | 324.184°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 13,14-Dihydro-16-Phenyl-omega-Tetranorprostaglandin E2 |