|
CAS#: 63834-66-2 Product: 1-[4-(2,3-Dihydroxypropoxy)Phenyl]-1-Butanone No suppilers available for the product. |
| Name | 1-[4-(2,3-Dihydroxypropoxy)Phenyl]-1-Butanone |
|---|---|
| Synonyms | 1,2-Propanediol, 3-(p-butyrylphenoxy)-; 3-(p-Butyrylphenoxy)-1,2-propanidiol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 |
| CAS Registry Number | 63834-66-2 |
| SMILES | O=C(c1ccc(OCC(O)CO)cc1)CCC |
| InChI | 1S/C13H18O4/c1-2-3-13(16)10-4-6-12(7-5-10)17-9-11(15)8-14/h4-7,11,14-15H,2-3,8-9H2,1H3 |
| InChIKey | OJSIHOCBTHOQJA-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.19°C at 760 mmHg (Cal.) |
| Flash point | 163.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(2,3-Dihydroxypropoxy)Phenyl]-1-Butanone |