|
CAS#: 63867-36-7 Product: N,N'-Bis(1-Carboxypropyl)Ethanebisthioamide No suppilers available for the product. |
| Name | N,N'-Bis(1-Carboxypropyl)Ethanebisthioamide |
|---|---|
| Synonyms | 2-[[2-(1-Carboxypropylamino)-2-Thioxo-Ethanethioyl]Amino]Butanoic Acid; 2-[[2-(1-Carboxypropylamino)-1,2-Dithioxoethyl]Amino]Butanoic Acid; 2-[[2-(1-Carboxypropylamino)-2-Thioxo-Thioacetyl]Amino]Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.37 |
| CAS Registry Number | 63867-36-7 |
| SMILES | C(C(NC(C(NC(C(O)=O)CC)=S)=S)C(O)=O)C |
| InChI | 1S/C10H16N2O4S2/c1-3-5(9(13)14)11-7(17)8(18)12-6(4-2)10(15)16/h5-6H,3-4H2,1-2H3,(H,11,17)(H,12,18)(H,13,14)(H,15,16) |
| InChIKey | DGCBTUVOSFPNQF-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.995°C at 760 mmHg (Cal.) |
| Flash point | 246.512°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis(1-Carboxypropyl)Ethanebisthioamide |