|
CAS#: 63868-44-0 Product: 17-Methylmorphinan-3,4,8beta-Triol No suppilers available for the product. |
| Name | 17-Methylmorphinan-3,4,8beta-Triol |
|---|---|
| Synonyms | Pseudomorphine, Tetrahydro-; Tetrahydropseudomorphine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 |
| CAS Registry Number | 63868-44-0 |
| SMILES | [C@]124[C@H]([C@H](N(CC1)C)CC3=CC=C(O)C(=C23)O)[C@@H](O)CCC4 |
| InChI | 1S/C17H23NO3/c1-18-8-7-17-6-2-3-12(19)15(17)11(18)9-10-4-5-13(20)16(21)14(10)17/h4-5,11-12,15,19-21H,2-3,6-9H2,1H3/t11-,12+,15-,17+/m1/s1 |
| InChIKey | ZVVPOIIWSXKHNF-LRHZJYQRSA-N |
| Density | 1.354g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.639°C at 760 mmHg (Cal.) |
| Flash point | 282.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17-Methylmorphinan-3,4,8beta-Triol |