|
CAS#: 63869-47-6 Product: 3-(Cyclobutylmethyl)-6,11-Dimethyl-1,2,3,4,5,6-Hexahydro-8-Methoxy-2,6-Methano-3-Benzazocine No suppilers available for the product. |
| Name | 3-(Cyclobutylmethyl)-6,11-Dimethyl-1,2,3,4,5,6-Hexahydro-8-Methoxy-2,6-Methano-3-Benzazocine |
|---|---|
| Synonyms | Win-23538 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 |
| CAS Registry Number | 63869-47-6 |
| SMILES | C1=C2C(=CC(=C1)OC)C3(CCN(C(C2)C3C)CC4CCC4)C |
| InChI | 1S/C20H29NO/c1-14-19-11-16-7-8-17(22-3)12-18(16)20(14,2)9-10-21(19)13-15-5-4-6-15/h7-8,12,14-15,19H,4-6,9-11,13H2,1-3H3 |
| InChIKey | JCWFROZXHUXCRM-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.846°C at 760 mmHg (Cal.) |
| Flash point | 118.431°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Cyclobutylmethyl)-6,11-Dimethyl-1,2,3,4,5,6-Hexahydro-8-Methoxy-2,6-Methano-3-Benzazocine |