|
CAS#: 63884-83-3 Product: Bis(2-Chloroethyl)Carbamic Acid 4-Nitroso-3,5-Xylyl Ester No suppilers available for the product. |
| Name | Bis(2-Chloroethyl)Carbamic Acid 4-Nitroso-3,5-Xylyl Ester |
|---|---|
| Synonyms | (3,5-Dimethyl-4-Nitroso-Phenyl) N,N-Bis(2-Chloroethyl)Carbamate; N,N-Bis(2-Chloroethyl)Carbamic Acid (3,5-Dimethyl-4-Nitrosophenyl) Ester; N,N-Bis(2-Chloroethyl)Carbamic Acid (3,5-Dimethyl-4-Nitroso-Phenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 |
| CAS Registry Number | 63884-83-3 |
| SMILES | C1=C(C(=C(C=C1OC(N(CCCl)CCCl)=O)C)N=O)C |
| InChI | 1S/C13H16Cl2N2O3/c1-9-7-11(8-10(2)12(9)16-19)20-13(18)17(5-3-14)6-4-15/h7-8H,3-6H2,1-2H3 |
| InChIKey | FZFLXPZCRIPDIE-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.64°C at 760 mmHg (Cal.) |
| Flash point | 233.597°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Chloroethyl)Carbamic Acid 4-Nitroso-3,5-Xylyl Ester |