|
CAS#: 63885-91-6 Product: 1-Methyl-9H-Pyrido[3,4-b]Indole-3-Methanamine No suppilers available for the product. |
| Name | 1-Methyl-9H-Pyrido[3,4-b]Indole-3-Methanamine |
|---|---|
| Synonyms | (1-Methyl-9H-$B-Carbolin-3-Yl)Methylamine; 9H-Pyrido(3,4-B)Indole, 3-Aminomethyl-1-Methyl-; Brn 0747890 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 |
| CAS Registry Number | 63885-91-6 |
| SMILES | C1=CC=CC3=C1C2=CC(=NC(=C2[NH]3)C)CN |
| InChI | 1S/C13H13N3/c1-8-13-11(6-9(7-14)15-8)10-4-2-3-5-12(10)16-13/h2-6,16H,7,14H2,1H3 |
| InChIKey | HEFWTWTYTSSMBE-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.862°C at 760 mmHg (Cal.) |
| Flash point | 247.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-9H-Pyrido[3,4-b]Indole-3-Methanamine |