|
CAS#: 63887-49-0 Product: 2-Acetoxy-3-Phenylbenzamide No suppilers available for the product. |
| Name | 2-Acetoxy-3-Phenylbenzamide |
|---|---|
| Synonyms | (2-Carbamoyl-6-Phenyl-Phenyl) Acetate; Acetic Acid (2-Carbamoyl-6-Phenylphenyl) Ester; Acetic Acid (2-Carbamoyl-6-Phenyl-Phenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 |
| CAS Registry Number | 63887-49-0 |
| SMILES | C1=C(C(=C(C=C1)C(N)=O)OC(C)=O)C2=CC=CC=C2 |
| InChI | 1S/C15H13NO3/c1-10(17)19-14-12(11-6-3-2-4-7-11)8-5-9-13(14)15(16)18/h2-9H,1H3,(H2,16,18) |
| InChIKey | JTVVOOSCIQPAQH-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.874°C at 760 mmHg (Cal.) |
| Flash point | 191.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetoxy-3-Phenylbenzamide |