|
CAS#: 63905-40-8 Product: 3-(Phenylthio)-N,N-Dimethyl-2-Propen-1-Amine No suppilers available for the product. |
| Name | 3-(Phenylthio)-N,N-Dimethyl-2-Propen-1-Amine |
|---|---|
| Synonyms | (E)-N,N-Dimethyl-3-Phenylsulfanyl-Prop-2-En-1-Amine; (E)-N,N-Dimethyl-3-(Phenylthio)Prop-2-En-1-Amine; Dimethyl-[(E)-3-(Phenylthio)Prop-2-Enyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 |
| CAS Registry Number | 63905-40-8 |
| SMILES | C1=C(S\C=C\CN(C)C)C=CC=C1 |
| InChI | 1S/C11H15NS/c1-12(2)9-6-10-13-11-7-4-3-5-8-11/h3-8,10H,9H2,1-2H3/b10-6+ |
| InChIKey | MUWIULGHAOVBOB-UXBLZVDNSA-N |
| Density | 1.038g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.944°C at 760 mmHg (Cal.) |
| Flash point | 121.897°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Phenylthio)-N,N-Dimethyl-2-Propen-1-Amine |