|
CAS#: 63906-88-7 Product: Digammacaine No suppilers available for the product. |
| Name | Digammacaine |
|---|---|
| Synonyms | N-(1-Phenyl-3-Piperidin-1-Ium-1-Yl-Propyl)Benzamide Chloride; N-[1-Phenyl-3-(1-Piperidin-1-Iumyl)Propyl]Benzamide Chloride; 1-Benzamido-1-Phenyl-3-Piperidinopropane Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 |
| CAS Registry Number | 63906-88-7 |
| SMILES | C1=CC=CC=C1C(NC(C2=CC=CC=C2)=O)CC[NH+]3CCCCC3.[Cl-] |
| InChI | 1S/C21H26N2O.ClH/c24-21(19-12-6-2-7-13-19)22-20(18-10-4-1-5-11-18)14-17-23-15-8-3-9-16-23;/h1-2,4-7,10-13,20H,3,8-9,14-17H2,(H,22,24);1H |
| InChIKey | YVBOFDGPWVOQBW-UHFFFAOYSA-N |
| Boiling point | 529.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 274.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Digammacaine |