|
CAS#: 63908-28-1 Product: 1,8-Dimethyl-3-Isobutyl-Xanthine No suppilers available for the product. |
| Name | 1,8-Dimethyl-3-Isobutyl-Xanthine |
|---|---|
| Synonyms | 3-Isobutyl-1,8-Dimethyl-7H-Purine-2,6-Dione; 3-Isobutyl-1,8-Dimethyl-7H-Purine-2,6-Quinone; 1H-Purine-2,6-Dione, 3,7-Dihydro-1,8-Dimethyl-3-(2-Methylpropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 63908-28-1 |
| SMILES | C(C(C)C)N1C(=O)N(C)C(=O)C2=C1N=C([NH]2)C |
| InChI | 1S/C11H16N4O2/c1-6(2)5-15-9-8(12-7(3)13-9)10(16)14(4)11(15)17/h6H,5H2,1-4H3,(H,12,13) |
| InChIKey | JGULMIZILIGJNC-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.8°C at 760 mmHg (Cal.) |
| Flash point | 233.693°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Dimethyl-3-Isobutyl-Xanthine |