|
CAS#: 6391-64-6 Product: 7-O-Methylantioquine No suppilers available for the product. |
| Name | 7-O-Methylantioquine |
|---|---|
| Synonyms | Chebi:8886; C09624 |
| Molecular Structure | ![]() |
| Molecular Formula | C38H42N2O6 |
| Molecular Weight | 622.76 |
| CAS Registry Number | 6391-64-6 |
| SMILES | [C@H]17C2=C(CCN1C)C=C(C(=C2OC3=CC4=C(C=C3OC)CCN([C@@H]4CC5=CC=C(C(=C5)C6=CC(=CC=C6OC)C7)O)C)OC)OC |
| InChI | 1S/C38H42N2O6/c1-39-13-11-24-19-33(43-4)34-21-26(24)29(39)17-22-7-9-31(41)27(15-22)28-16-23(8-10-32(28)42-3)18-30-36-25(12-14-40(30)2)20-35(44-5)37(45-6)38(36)46-34/h7-10,15-16,19-21,29-30,41H,11-14,17-18H2,1-6H3/t29-,30+/m1/s1 |
| InChIKey | HIQZXOFBXJICTD-IHLOFXLRSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 745.356°C at 760 mmHg (Cal.) |
| Flash point | 404.577°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-O-Methylantioquine |