|
CAS#: 63938-02-3 Product: (+)-1,2,3,4,5,6,7,8-Octahydro-2-Methyl-1-(4-Nitrophenethyl)Isoquinoline No suppilers available for the product. |
| Name | (+)-1,2,3,4,5,6,7,8-Octahydro-2-Methyl-1-(4-Nitrophenethyl)Isoquinoline |
|---|---|
| Synonyms | 1-(4-Nitrophenethyl)-2-Methyl-1,2,3,4,5,6,7,8-Octahydroisoquinoline; Brn 4149541; Isoquinoline, 1,2,3,4,5,6,7,8-Octahydro-2-Methyl-1-(4-Nitrophenethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 |
| CAS Registry Number | 63938-02-3 |
| SMILES | C3=C(CCC1N(CCC2=C1CCCC2)C)C=CC(=C3)[N+]([O-])=O |
| InChI | 1S/C18H24N2O2/c1-19-13-12-15-4-2-3-5-17(15)18(19)11-8-14-6-9-16(10-7-14)20(21)22/h6-7,9-10,18H,2-5,8,11-13H2,1H3 |
| InChIKey | NHZSGFPRDZNUNP-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.294°C at 760 mmHg (Cal.) |
| Flash point | 226.735°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+)-1,2,3,4,5,6,7,8-Octahydro-2-Methyl-1-(4-Nitrophenethyl)Isoquinoline |