|
CAS#: 639461-53-3 Product: 6-[(3-Aminophenyl)carbamoyl]-3-cyclohexene-1-carboxylic acid No suppilers available for the product. |
| Name | 6-[(3-Aminophenyl)carbamoyl]-3-cyclohexene-1-carboxylic acid |
|---|---|
| Synonyms | 3-CYCLOHE |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 |
| CAS Registry Number | 639461-53-3 |
| SMILES | O=C(Nc1cccc(N)c1)C2C\C=C/CC2C(O)=O |
| InChI | 1S/C14H16N2O3/c15-9-4-3-5-10(8-9)16-13(17)11-6-1-2-7-12(11)14(18)19/h1-5,8,11-12H,6-7,15H2,(H,16,17)(H,18,19) |
| InChIKey | AJJDMTGVIMGVRF-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 575.907°C at 760 mmHg (Cal.) |
| Flash point | 302.098°C (Cal.) |
| Refractive index | 1.662 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-[(3-Aminophenyl)carbamoyl]-3-cyclohexene-1-carboxylic acid |