|
CAS#: 63949-91-7 Product: N,N-DiethylEthanamine (S)-(1-methyl-2-phenylethyl)carbamodithioate No suppilers available for the product. |
| Name | N,N-DiethylEthanamine (S)-(1-methyl-2-phenylethyl)carbamodithioate |
|---|---|
| Synonyms | N,N-Diethylethanamine; [[(1S)-1-Methyl-2-Phenyl-Ethyl]Amino]Methanedithioic Acid; N,N-Diethylethanamine; [[(1S)-1-Methyl-2-Phenylethyl]Amino]Methanedithioic Acid; [[(1S)-1-Methyl-2-Phenyl-Ethyl]Amino]Methanedithioic Acid; Triethylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H28N2S2 |
| Molecular Weight | 312.53 |
| CAS Registry Number | 63949-91-7 |
| SMILES | [C@@H](NC(=S)S)(CC1=CC=CC=C1)C.C(N(CC)CC)C |
| InChI | 1S/C10H13NS2.C6H15N/c1-8(11-10(12)13)7-9-5-3-2-4-6-9;1-4-7(5-2)6-3/h2-6,8H,7H2,1H3,(H2,11,12,13);4-6H2,1-3H3/t8-;/m0./s1 |
| InChIKey | FCLLXVMLKVGSCO-QRPNPIFTSA-N |
| Boiling point | 309.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 141.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-DiethylEthanamine (S)-(1-methyl-2-phenylethyl)carbamodithioate |