|
CAS#: 63958-66-7 Product: 4,5-Dihydroxyphthalic Acid No suppilers available for the product. |
| Name | 4,5-Dihydroxyphthalic Acid |
|---|---|
| Synonyms | 1,2-Benzenedicarboxylic Acid, 4,5-Dihydroxy-; 4,5-Dhpa; 4,5-Dihydroxyphthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 |
| CAS Registry Number | 63958-66-7 |
| SMILES | C1=C(O)C(=CC(=C1C(O)=O)C(O)=O)O |
| InChI | 1S/C8H6O6/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | YZBCICVNBHNLTK-UHFFFAOYSA-N |
| Density | 1.779g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.776°C at 760 mmHg (Cal.) |
| Flash point | 291.898°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dihydroxyphthalic Acid |