|
CAS#: 63978-91-6 Product: 2-Di(2-Chloroethyl)Amino-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2-Di(2-Chloroethyl)Amino-1,4-Naphthoquinone |
|---|---|
| Synonyms | 2-[Bis(2-Chloroethyl)Amino]-1,4-Naphthoquinone; 1,4-Naphthalenedione, 2-[Bis(2-Chloroethyl)Amino]-; Nsc260640 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13Cl2NO2 |
| Molecular Weight | 298.17 |
| CAS Registry Number | 63978-91-6 |
| SMILES | C1=CC=CC2=C1C(C(=CC2=O)N(CCCl)CCCl)=O |
| InChI | 1S/C14H13Cl2NO2/c15-5-7-17(8-6-16)12-9-13(18)10-3-1-2-4-11(10)14(12)19/h1-4,9H,5-8H2 |
| InChIKey | PHLZLDBVNZSBRA-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.821°C at 760 mmHg (Cal.) |
| Flash point | 216.168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Di(2-Chloroethyl)Amino-1,4-Naphthoquinone |