|
CAS#: 63980-12-1 Product: 4-(Trichloromethyl)Benzoic Acid 2-Chloroethyl Ester No suppilers available for the product. |
| Name | 4-(Trichloromethyl)Benzoic Acid 2-Chloroethyl Ester |
|---|---|
| Synonyms | 4-(Trichloromethyl)Benzoic Acid 2-Chloroethyl Ester; 4-09-00-01744 (Beilstein Handbook Reference); Brn 3311587 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl4O2 |
| Molecular Weight | 301.98 |
| CAS Registry Number | 63980-12-1 |
| SMILES | C1=C(C=CC(=C1)C(Cl)(Cl)Cl)C(OCCCl)=O |
| InChI | 1S/C10H8Cl4O2/c11-5-6-16-9(15)7-1-3-8(4-2-7)10(12,13)14/h1-4H,5-6H2 |
| InChIKey | FYQVQCVGCOEMQQ-UHFFFAOYSA-N |
| Density | 1.462g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.056°C at 760 mmHg (Cal.) |
| Flash point | 153.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Trichloromethyl)Benzoic Acid 2-Chloroethyl Ester |