|
CAS#: 63981-32-8 Product: 6-Amino-3-Ethyl-1-Propyluracil No suppilers available for the product. |
| Name | 6-Amino-3-Ethyl-1-Propyluracil |
|---|---|
| Synonyms | 6-Amino-3-Ethyl-1-Propyl-Pyrimidine-2,4-Dione; 6-Amino-3-Ethyl-1-Propyl-Pyrimidine-2,4-Quinone; 6-Amino-3-Ethyl-1-Propyluracil |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 |
| CAS Registry Number | 63981-32-8 |
| SMILES | C(N1C(=O)N(C(=O)C=C1N)CC)CC |
| InChI | 1S/C9H15N3O2/c1-3-5-12-7(10)6-8(13)11(4-2)9(12)14/h6H,3-5,10H2,1-2H3 |
| InChIKey | NUEJYQRPPDNSDM-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.369°C at 760 mmHg (Cal.) |
| Flash point | 130.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-3-Ethyl-1-Propyluracil |