|
CAS#: 639815-71-7 Product: 5-Hydroxy-5-(trichloromethyl)-1,2-oxazolidin-3-one No suppilers available for the product. |
| Name | 5-Hydroxy-5-(trichloromethyl)-1,2-oxazolidin-3-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C4H4Cl3NO3 |
| Molecular Weight | 220.44 |
| CAS Registry Number | 639815-71-7 |
| SMILES | ClC(Cl)(Cl)C1(O)ONC(=O)C1 |
| InChI | 1S/C4H4Cl3NO3/c5-4(6,7)3(10)1-2(9)8-11-3/h10H,1H2,(H,8,9) |
| InChIKey | KAGSQJDUBUSCMF-UHFFFAOYSA-N |
| Density | 1.859g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.7°C at 760 mmHg (Cal.) |
| Flash point | 165.3°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxy-5-(trichloromethyl)-1,2-oxazolidin-3-one |