|
CAS#: 63991-70-8 Product: 4'-(4-Acetylamino-3-Methylphenyl)Acetanilide No suppilers available for the product. |
| Name | 4'-(4-Acetylamino-3-Methylphenyl)Acetanilide |
|---|---|
| Synonyms | N-[4-(4-Acetamidophenyl)-2-Methyl-Phenyl]Acetamide; N-[4-(4-Acetamidophenyl)-2-Methyl-Phenyl]Ethanamide; 2-Methyldiacetylbenzidine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 |
| CAS Registry Number | 63991-70-8 |
| SMILES | C2=C(C1=CC=C(NC(=O)C)C=C1)C=CC(=C2C)NC(=O)C |
| InChI | 1S/C17H18N2O2/c1-11-10-15(6-9-17(11)19-13(3)21)14-4-7-16(8-5-14)18-12(2)20/h4-10H,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | JIHXYUQHOMKXAU-UHFFFAOYSA-N |
| Density | 1.191g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.109°C at 760 mmHg (Cal.) |
| Flash point | 204.264°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-(4-Acetylamino-3-Methylphenyl)Acetanilide |